C22H22N6O4S2 — CID 90073029
3-[6-amino-8-[[2-(2-ethynylphenyl)-1,3-dioxol-4-yl]sulfanyl]purin-9-yl]-N-cyclopropylpropane-1-sulfonamide (PubChem CID 90073029) has the molecular formula C22H22N6O4S2 and a molecular weight of 498.59 g/mol. Its IUPAC name is 3-[6-amino-8-[[2-(2-ethynylphenyl)-1,3-dioxol-4-yl]sulfanyl]purin-9-yl]-N-cyclopropylpropane-1-sulfonamide.
| Compound Name | 3-[6-amino-8-[[2-(2-ethynylphenyl)-1,3-dioxol-4-yl]sulfanyl]purin-9-yl]-N-cyclopropylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 90073029 |
| Molecular Formula | C22H22N6O4S2 |
| Molecular Weight | 498.59 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | 3-[6-amino-8-[[2-(2-ethynylphenyl)-1,3-dioxol-4-yl]sulfanyl]purin-9-yl]-N-cyclopropylpropane-1-sulfonamide |
| SMILES | C#Cc1ccccc1C1OC=C(Sc2nc3c(N)ncnc3n2CCCS(=O)(=O)NC2CC2)O1 |
| InChI | InChI=1S/C22H22N6O4S2/c1-2-14-6-3-4-7-16(14)21-31-12-17(32-21)33-22-26-18-19(23)24-13-25-20(18)28(22)10-5-11-34(29,30)27-15-8-9-15/h1,3-4,6-7,12-13,15,21,27H,5,8-11H2,(H2,23,24,25) |
| InChIKey | GMHIMMUHNMUBTI-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 134.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.59 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|