C21H22N8O4S2 — CID 90072748
N-[3-[6-amino-8-[[2-[2-(1H-pyrazol-5-yl)phenyl]-1,3-dioxol-4-yl]sulfanyl]purin-9-yl]propyl]methanesulfonamide (PubChem CID 90072748) has the molecular formula C21H22N8O4S2 and a molecular weight of 514.59 g/mol. Its IUPAC name is N-[3-[6-amino-8-[[2-[2-(1H-pyrazol-5-yl)phenyl]-1,3-dioxol-4-yl]sulfanyl]purin-9-yl]propyl]methanesulfonamide.
| Compound Name | N-[3-[6-amino-8-[[2-[2-(1H-pyrazol-5-yl)phenyl]-1,3-dioxol-4-yl]sulfanyl]purin-9-yl]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 90072748 |
| Molecular Formula | C21H22N8O4S2 |
| Molecular Weight | 514.59 g/mol |
| Exact Mass | 514.12 |
| IUPAC Name | N-[3-[6-amino-8-[[2-[2-(1H-pyrazol-5-yl)phenyl]-1,3-dioxol-4-yl]sulfanyl]purin-9-yl]propyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCCn1c(SC2=COC(c3ccccc3-c3ccn[nH]3)O2)nc2c(N)ncnc21 |
| InChI | InChI=1S/C21H22N8O4S2/c1-35(30,31)26-8-4-10-29-19-17(18(22)23-12-24-19)27-21(29)34-16-11-32-20(33-16)14-6-3-2-5-13(14)15-7-9-25-28-15/h2-3,5-7,9,11-12,20,26H,4,8,10H2,1H3,(H,25,28)(H2,22,23,24) |
| InChIKey | LJMCUWOXHHNPFV-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 162.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.59 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|