C24H31N7O3S — CID 90073165
N-[3-[6-amino-8-[[2-[2-(dimethylamino)phenyl]-1,3-dioxol-4-yl]sulfanyl]purin-9-yl]propyl]-2,2-dimethylpropanamide (PubChem CID 90073165) has the molecular formula C24H31N7O3S and a molecular weight of 497.63 g/mol. Its IUPAC name is N-[3-[6-amino-8-[[2-[2-(dimethylamino)phenyl]-1,3-dioxol-4-yl]sulfanyl]purin-9-yl]propyl]-2,2-dimethylpropanamide.
| Compound Name | N-[3-[6-amino-8-[[2-[2-(dimethylamino)phenyl]-1,3-dioxol-4-yl]sulfanyl]purin-9-yl]propyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 90073165 |
| Molecular Formula | C24H31N7O3S |
| Molecular Weight | 497.63 g/mol |
| Exact Mass | 497.22 |
| IUPAC Name | N-[3-[6-amino-8-[[2-[2-(dimethylamino)phenyl]-1,3-dioxol-4-yl]sulfanyl]purin-9-yl]propyl]-2,2-dimethylpropanamide |
| SMILES | CN(C)c1ccccc1C1OC=C(Sc2nc3c(N)ncnc3n2CCCNC(=O)C(C)(C)C)O1 |
| InChI | InChI=1S/C24H31N7O3S/c1-24(2,3)22(32)26-11-8-12-31-20-18(19(25)27-14-28-20)29-23(31)35-17-13-33-21(34-17)15-9-6-7-10-16(15)30(4)5/h6-7,9-10,13-14,21H,8,11-12H2,1-5H3,(H,26,32)(H2,25,27,28) |
| InChIKey | ATEOQPWZJXMGOU-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.63 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|