C23H24N6O3S — CID 90072563
N-[3-[6-amino-8-[[2-(2-ethynylphenyl)-1,3-dioxol-4-yl]sulfanyl]purin-9-yl]propyl]-2-methylpropanamide (PubChem CID 90072563) has the molecular formula C23H24N6O3S and a molecular weight of 464.55 g/mol. Its IUPAC name is N-[3-[6-amino-8-[[2-(2-ethynylphenyl)-1,3-dioxol-4-yl]sulfanyl]purin-9-yl]propyl]-2-methylpropanamide.
| Compound Name | N-[3-[6-amino-8-[[2-(2-ethynylphenyl)-1,3-dioxol-4-yl]sulfanyl]purin-9-yl]propyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 90072563 |
| Molecular Formula | C23H24N6O3S |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | N-[3-[6-amino-8-[[2-(2-ethynylphenyl)-1,3-dioxol-4-yl]sulfanyl]purin-9-yl]propyl]-2-methylpropanamide |
| SMILES | C#Cc1ccccc1C1OC=C(Sc2nc3c(N)ncnc3n2CCCNC(=O)C(C)C)O1 |
| InChI | InChI=1S/C23H24N6O3S/c1-4-15-8-5-6-9-16(15)22-31-12-17(32-22)33-23-28-18-19(24)26-13-27-20(18)29(23)11-7-10-25-21(30)14(2)3/h1,5-6,8-9,12-14,22H,7,10-11H2,2-3H3,(H,25,30)(H2,24,26,27) |
| InChIKey | ZCPYELBWCYMBGF-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 117.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|