C16H25BN6O6P+ — CID 90088724
CID 90088724 (PubChem CID 90088724) has the molecular formula C16H25BN6O6P+ and a molecular weight of 439.20 g/mol.
| Compound Name | CID 90088724 |
|---|---|
| PubChem CID | 90088724 |
| Molecular Formula | C16H25BN6O6P+ |
| Molecular Weight | 439.20 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | — |
| SMILES | [B][P+](O)(OC)OC[C@@H]1C[C@H](O)[C@H](n2cnc3c(NC(=O)NC(C)(C)C)ncnc32)O1 |
| InChI | InChI=1S/C16H25BN6O6P/c1-16(2,3)22-15(25)21-12-11-13(19-7-18-12)23(8-20-11)14-10(24)5-9(29-14)6-28-30(17,26)27-4/h7-10,14,24,26H,5-6H2,1-4H3,(H2,18,19,21,22,25)/q+1/t9-,10-,14+,30?/m0/s1 |
| InChIKey | MULARYTXLDZREL-RKCXBXGCSA-N |
| XLogP | 0.90 |
| TPSA | 152.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.20 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|