C13H20BN5O6PS+ — CID 90088690
CID 90088690 (PubChem CID 90088690) has the molecular formula C13H20BN5O6PS+ and a molecular weight of 416.19 g/mol.
| Compound Name | CID 90088690 |
|---|---|
| PubChem CID | 90088690 |
| Molecular Formula | C13H20BN5O6PS+ |
| Molecular Weight | 416.19 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | — |
| SMILES | [B][P+](O)(OC)OC[C@@H]1C[C@H](O)[C@H](n2cnc3c(N)nc(SCCO)nc32)O1 |
| InChI | InChI=1S/C13H20BN5O6PS/c1-23-26(14,22)24-5-7-4-8(21)12(25-7)19-6-16-9-10(15)17-13(18-11(9)19)27-3-2-20/h6-8,12,20-22H,2-5H2,1H3,(H2,15,17,18)/q+1/t7-,8-,12+,26?/m0/s1 |
| InChIKey | YJEIQQBMRNUBMX-KCINGBOPSA-N |
| XLogP | -0.36 |
| TPSA | 158.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.19 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|