C25H48N2 — CID 90126668
1-N,1-N-diethyl-5-N-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]hexane-1,5-diamine (PubChem CID 90126668) has the molecular formula C25H48N2 and a molecular weight of 376.67 g/mol. Its IUPAC name is 1-N,1-N-diethyl-5-N-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]hexane-1,5-diamine.
| Compound Name | 1-N,1-N-diethyl-5-N-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]hexane-1,5-diamine |
|---|---|
| PubChem CID | 90126668 |
| Molecular Formula | C25H48N2 |
| Molecular Weight | 376.67 g/mol |
| Exact Mass | 376.38 |
| IUPAC Name | 1-N,1-N-diethyl-5-N-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]hexane-1,5-diamine |
| SMILES | CCN(CC)CCCCC(C)NC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C25H48N2/c1-8-27(9-2)21-11-10-18-25(7)26-20-19-24(6)17-13-16-23(5)15-12-14-22(3)4/h14,16,19,25-26H,8-13,15,17-18,20-21H2,1-7H3/b23-16+,24-19+ |
| InChIKey | PIEBSGPXEWLYQK-FXSINEHXSA-N |
| XLogP | 6.90 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.67 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|