C16H19N3 — CID 90136135
2-amino-4-pentyl-5-prop-2-enylbenzene-1,3-dicarbonitrile (PubChem CID 90136135) has the molecular formula C16H19N3 and a molecular weight of 253.35 g/mol. Its IUPAC name is 2-amino-4-pentyl-5-prop-2-enylbenzene-1,3-dicarbonitrile.
| Compound Name | 2-amino-4-pentyl-5-prop-2-enylbenzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 90136135 |
| Molecular Formula | C16H19N3 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | 2-amino-4-pentyl-5-prop-2-enylbenzene-1,3-dicarbonitrile |
| SMILES | C=CCc1cc(C#N)c(N)c(C#N)c1CCCCC |
| InChI | InChI=1S/C16H19N3/c1-3-5-6-8-14-12(7-4-2)9-13(10-17)16(19)15(14)11-18/h4,9H,2-3,5-8,19H2,1H3 |
| InChIKey | XASGJHWHSXKPQK-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 73.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|