C25H42N6O6S4 — CID 90140938
1-butyl-3-(3-sulfanylpropyl)-5-[3-[3-[2,4,6-trioxo-3,5-bis(3-sulfanylpropyl)-1,3,5-triazinan-1-yl]propylsulfanyl]propyl]-1,3,5-triazinane-2,4,6-trione (PubChem CID 90140938) has the molecular formula C25H42N6O6S4 and a molecular weight of 650.91 g/mol. Its IUPAC name is 1-butyl-3-(3-sulfanylpropyl)-5-[3-[3-[2,4,6-trioxo-3,5-bis(3-sulfanylpropyl)-1,3,5-triazinan-1-yl]propylsulfanyl]propyl]-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-butyl-3-(3-sulfanylpropyl)-5-[3-[3-[2,4,6-trioxo-3,5-bis(3-sulfanylpropyl)-1,3,5-triazinan-1-yl]propylsulfanyl]propyl]-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 90140938 |
| Molecular Formula | C25H42N6O6S4 |
| Molecular Weight | 650.91 g/mol |
| Exact Mass | 650.20 |
| IUPAC Name | 1-butyl-3-(3-sulfanylpropyl)-5-[3-[3-[2,4,6-trioxo-3,5-bis(3-sulfanylpropyl)-1,3,5-triazinan-1-yl]propylsulfanyl]propyl]-1,3,5-triazinane-2,4,6-trione |
| SMILES | CCCCn1c(=O)n(CCCS)c(=O)n(CCCSCCCn2c(=O)n(CCCS)c(=O)n(CCCS)c2=O)c1=O |
| InChI | InChI=1S/C25H42N6O6S4/c1-2-3-9-26-20(32)27(10-4-15-38)23(35)30(21(26)33)13-7-18-41-19-8-14-31-24(36)28(11-5-16-39)22(34)29(25(31)37)12-6-17-40/h38-40H,2-19H2,1H3 |
| InChIKey | WCALYBCLQDJTQZ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 132.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.91 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|