C12H21N3O3S3 — CID 88895546
1-propylsulfanyl-3,5-bis(3-sulfanylpropyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 88895546) has the molecular formula C12H21N3O3S3 and a molecular weight of 351.52 g/mol. Its IUPAC name is 1-propylsulfanyl-3,5-bis(3-sulfanylpropyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-propylsulfanyl-3,5-bis(3-sulfanylpropyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 88895546 |
| Molecular Formula | C12H21N3O3S3 |
| Molecular Weight | 351.52 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | 1-propylsulfanyl-3,5-bis(3-sulfanylpropyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | CCCSn1c(=O)n(CCCS)c(=O)n(CCCS)c1=O |
| InChI | InChI=1S/C12H21N3O3S3/c1-2-9-21-15-11(17)13(5-3-7-19)10(16)14(12(15)18)6-4-8-20/h19-20H,2-9H2,1H3 |
| InChIKey | KYRFCXVMKJMTEB-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 66.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.52 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|