C10H17N3O3S3 — CID 21337093
1-(sulfanylmethyl)-3,5-bis(3-sulfanylpropyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 21337093) has the molecular formula C10H17N3O3S3 and a molecular weight of 323.47 g/mol. Its IUPAC name is 1-(sulfanylmethyl)-3,5-bis(3-sulfanylpropyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-(sulfanylmethyl)-3,5-bis(3-sulfanylpropyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 21337093 |
| Molecular Formula | C10H17N3O3S3 |
| Molecular Weight | 323.47 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | 1-(sulfanylmethyl)-3,5-bis(3-sulfanylpropyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | O=c1n(CS)c(=O)n(CCCS)c(=O)n1CCCS |
| InChI | InChI=1S/C10H17N3O3S3/c14-8-11(3-1-5-17)9(15)13(7-19)10(16)12(8)4-2-6-18/h17-19H,1-7H2 |
| InChIKey | DSSZBKHMUDLQEA-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 66.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.47 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|