C23H27NO3 — CID 90148749
methyl 3-[(1R,9R)-13-hydroxy-1,4,10-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-yl]benzoate (PubChem CID 90148749) has the molecular formula C23H27NO3 and a molecular weight of 365.47 g/mol. Its IUPAC name is methyl 3-[(1R,9R)-13-hydroxy-1,4,10-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-yl]benzoate.
| Compound Name | methyl 3-[(1R,9R)-13-hydroxy-1,4,10-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-yl]benzoate |
|---|---|
| PubChem CID | 90148749 |
| Molecular Formula | C23H27NO3 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | methyl 3-[(1R,9R)-13-hydroxy-1,4,10-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-yl]benzoate |
| SMILES | COC(=O)c1cccc(C2(O)[C@H]3Cc4ccc(C)cc4[C@@]2(C)CCN3C)c1 |
| InChI | InChI=1S/C23H27NO3/c1-15-8-9-16-14-20-23(26,18-7-5-6-17(13-18)21(25)27-4)22(2,19(16)12-15)10-11-24(20)3/h5-9,12-13,20,26H,10-11,14H2,1-4H3/t20-,22-,23?/m1/s1 |
| InChIKey | KOYXXMYNKSYEBF-OPSDPNGSSA-N |
| XLogP | 3.19 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |