C22H25NO2 — CID 90148708
3-[(1S,9R,13R)-1,4,10-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-yl]benzoic acid (PubChem CID 90148708) has the molecular formula C22H25NO2 and a molecular weight of 335.45 g/mol. Its IUPAC name is 3-[(1S,9R,13R)-1,4,10-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-yl]benzoic acid.
| Compound Name | 3-[(1S,9R,13R)-1,4,10-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-yl]benzoic acid |
|---|---|
| PubChem CID | 90148708 |
| Molecular Formula | C22H25NO2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | 3-[(1S,9R,13R)-1,4,10-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-yl]benzoic acid |
| SMILES | Cc1ccc2c(c1)[C@@]1(C)CCN(C)[C@H](C2)[C@@H]1c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C22H25NO2/c1-14-7-8-15-13-19-20(16-5-4-6-17(12-16)21(24)25)22(2,18(15)11-14)9-10-23(19)3/h4-8,11-12,19-20H,9-10,13H2,1-3H3,(H,24,25)/t19-,20+,22-/m1/s1 |
| InChIKey | BSGYQSUHFKNSDC-RZUBCFFCSA-N |
| XLogP | 3.99 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |