C6H6NNaO3S — CID 90150897
sodium 2-(2-methoxy-1,3-thiazol-4-yl)acetate (PubChem CID 90150897) has the molecular formula C6H6NNaO3S and a molecular weight of 195.17 g/mol. Its IUPAC name is sodium 2-(2-methoxy-1,3-thiazol-4-yl)acetate.
| Compound Name | sodium 2-(2-methoxy-1,3-thiazol-4-yl)acetate |
|---|---|
| PubChem CID | 90150897 |
| Molecular Formula | C6H6NNaO3S |
| Molecular Weight | 195.17 g/mol |
| Exact Mass | 195.00 |
| IUPAC Name | sodium 2-(2-methoxy-1,3-thiazol-4-yl)acetate |
| SMILES | COc1nc(CC(=O)[O-])cs1.[Na+] |
| InChI | InChI=1S/C6H7NO3S.Na/c1-10-6-7-4(3-11-6)2-5(8)9;/h3H,2H2,1H3,(H,8,9);/q;+1/p-1 |
| InChIKey | YBMCLUNBAGMXSA-UHFFFAOYSA-M |
| XLogP | -3.55 |
| TPSA | 62.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.17 |
| LogP ≤ 5 | -3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |