C13H19NO6S — CID 90159633
[3-methoxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl] methanesulfonate (PubChem CID 90159633) has the molecular formula C13H19NO6S and a molecular weight of 317.36 g/mol. Its IUPAC name is [3-methoxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl] methanesulfonate.
| Compound Name | [3-methoxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 90159633 |
| Molecular Formula | C13H19NO6S |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | [3-methoxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl] methanesulfonate |
| SMILES | COc1cc(NC(=O)OC(C)(C)C)cc(OS(C)(=O)=O)c1 |
| InChI | InChI=1S/C13H19NO6S/c1-13(2,3)19-12(15)14-9-6-10(18-4)8-11(7-9)20-21(5,16)17/h6-8H,1-5H3,(H,14,15) |
| InChIKey | CNMCPUFHYHIJJU-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|