C33H35F3N2O4 — CID 90165624
[(2R,4aR,10aR)-7-[(2-methyl-3-pyridinyl)carbamoyl]-4a-phenyl-2-(trifluoromethyl)-1,3,4,9,10,10a-hexahydrophenanthren-2-yl] 2-methylpropyl carbonate (PubChem CID 90165624) has the molecular formula C33H35F3N2O4 and a molecular weight of 580.65 g/mol. Its IUPAC name is [(2R,4aR,10aR)-7-[(2-methyl-3-pyridinyl)carbamoyl]-4a-phenyl-2-(trifluoromethyl)-1,3,4,9,10,10a-hexahydrophenanthren-2-yl] 2-methylpropyl carbonate.
| Compound Name | [(2R,4aR,10aR)-7-[(2-methyl-3-pyridinyl)carbamoyl]-4a-phenyl-2-(trifluoromethyl)-1,3,4,9,10,10a-hexahydrophenanthren-2-yl] 2-methylpropyl carbonate |
|---|---|
| PubChem CID | 90165624 |
| Molecular Formula | C33H35F3N2O4 |
| Molecular Weight | 580.65 g/mol |
| Exact Mass | 580.25 |
| IUPAC Name | [(2R,4aR,10aR)-7-[(2-methyl-3-pyridinyl)carbamoyl]-4a-phenyl-2-(trifluoromethyl)-1,3,4,9,10,10a-hexahydrophenanthren-2-yl] 2-methylpropyl carbonate |
| SMILES | Cc1ncccc1NC(=O)c1ccc2c(c1)CC[C@@H]1C[C@@](OC(=O)OCC(C)C)(C(F)(F)F)CC[C@@]21c1ccccc1 |
| InChI | InChI=1S/C33H35F3N2O4/c1-21(2)20-41-30(40)42-31(33(34,35)36)15-16-32(25-8-5-4-6-9-25)26(19-31)13-11-23-18-24(12-14-27(23)32)29(39)38-28-10-7-17-37-22(28)3/h4-10,12,14,17-18,21,26H,11,13,15-16,19-20H2,1-3H3,(H,38,39)/t26-,31-,32+/m1/s1 |
| InChIKey | ZUMLXVJWVQPMMN-WBKIGWJKSA-N |
| XLogP | 7.79 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.65 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |