About CID 90172032
CID 90172032 (PubChem CID 90172032) has the molecular formula C10H13F2O3Si
and a molecular weight of 247.29 g/mol.
Molecular Properties
| Compound Name | CID 90172032 |
| PubChem CID | 90172032 |
| Molecular Formula | C10H13F2O3Si |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | — |
| SMILES | CO[Si](OC)OCCc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C10H13F2O3Si/c1-13-16(14-2)15-6-5-8-3-4-9(11)10(12)7-8/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | KQQMSONNVBZJCG-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 90172032 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 90172032?
The IUPAC name of CID 90172032 (CID 90172032) is not available.
What is the SMILES notation for CID 90172032?
The canonical SMILES for CID 90172032 is CO[Si](OC)OCCc1ccc(F)c(F)c1.
What is the InChIKey of CID 90172032?
The InChIKey is KQQMSONNVBZJCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13F2O3Si/c1-13-16(14-2)15-6-5-8-3-4-9(11)10(12)7-8/h3-4,7H,5-6H2,1-2H3.
What are the key properties of CID 90172032?
CID 90172032 has a molecular weight of 247.29 g/mol, XLogP of 1.80, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 90172032 is sourced from PubChem (CID 90172032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).