C32H35Cl2N2O10S- — CID 90187281
3,5-dichloro-4-[2-[3-(cyclopropylmethoxy)-4-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-sulfinatoamino]benzoyl]oxy-2-(3,4-dimethoxyphenyl)ethyl]-1-oxidopyridin-1-ium (PubChem CID 90187281) has the molecular formula C32H35Cl2N2O10S- and a molecular weight of 710.61 g/mol. Its IUPAC name is 3,5-dichloro-4-[2-[3-(cyclopropylmethoxy)-4-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-sulfinatoamino]benzoyl]oxy-2-(3,4-dimethoxyphenyl)ethyl]-1-oxidopyridin-1-ium.
| Compound Name | 3,5-dichloro-4-[2-[3-(cyclopropylmethoxy)-4-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-sulfinatoamino]benzoyl]oxy-2-(3,4-dimethoxyphenyl)ethyl]-1-oxidopyridin-1-ium |
|---|---|
| PubChem CID | 90187281 |
| Molecular Formula | C32H35Cl2N2O10S- |
| Molecular Weight | 710.61 g/mol |
| Exact Mass | 709.14 |
| IUPAC Name | 3,5-dichloro-4-[2-[3-(cyclopropylmethoxy)-4-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-sulfinatoamino]benzoyl]oxy-2-(3,4-dimethoxyphenyl)ethyl]-1-oxidopyridin-1-ium |
| SMILES | COc1ccc(C(Cc2c(Cl)c[n+]([O-])cc2Cl)OC(=O)c2ccc(N(CC(=O)OC(C)(C)C)S(=O)[O-])c(OCC3CC3)c2)cc1OC |
| InChI | InChI=1S/C32H36Cl2N2O10S/c1-32(2,3)46-30(37)17-36(47(40)41)25-10-8-21(13-28(25)44-18-19-6-7-19)31(38)45-27(14-22-23(33)15-35(39)16-24(22)34)20-9-11-26(42-4)29(12-20)43-5/h8-13,15-16,19,27H,6-7,14,17-18H2,1-5H3,(H,40,41)/p-1 |
| InChIKey | WXZYGSOHHQWANU-UHFFFAOYSA-M |
| XLogP | 5.52 |
| TPSA | 150.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.61 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|