C18H27FN6O7P+ — CID 90189058
propan-2-yl 2-[[(4aR,6R,7R,7aR)-6-(2-amino-6-ethoxypurin-9-yl)-7-fluoro-2-hydroxy-7-methyl-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-ium-2-yl]amino]acetate (PubChem CID 90189058) has the molecular formula C18H27FN6O7P+ and a molecular weight of 489.42 g/mol. Its IUPAC name is propan-2-yl 2-[[(4aR,6R,7R,7aR)-6-(2-amino-6-ethoxypurin-9-yl)-7-fluoro-2-hydroxy-7-methyl-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-ium-2-yl]amino]acetate.
| Compound Name | propan-2-yl 2-[[(4aR,6R,7R,7aR)-6-(2-amino-6-ethoxypurin-9-yl)-7-fluoro-2-hydroxy-7-methyl-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-ium-2-yl]amino]acetate |
|---|---|
| PubChem CID | 90189058 |
| Molecular Formula | C18H27FN6O7P+ |
| Molecular Weight | 489.42 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | propan-2-yl 2-[[(4aR,6R,7R,7aR)-6-(2-amino-6-ethoxypurin-9-yl)-7-fluoro-2-hydroxy-7-methyl-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-ium-2-yl]amino]acetate |
| SMILES | CCOc1nc(N)nc2c1ncn2[C@@H]1O[C@@H]2CO[P+](O)(NCC(=O)OC(C)C)O[C@H]2[C@@]1(C)F |
| InChI | InChI=1S/C18H27FN6O7P/c1-5-28-15-12-14(23-17(20)24-15)25(8-21-12)16-18(4,19)13-10(31-16)7-29-33(27,32-13)22-6-11(26)30-9(2)3/h8-10,13,16,22,27H,5-7H2,1-4H3,(H2,20,23,24)/q+1/t10-,13-,16-,18-,33?/m1/s1 |
| InChIKey | YJFGBKSGRVSARN-KXUUPDONSA-N |
| XLogP | 1.06 |
| TPSA | 165.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.42 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|