C63H50N2Si2 — CID 90195239
5,5-diphenyl-N-[4-(9-phenylcarbazol-3-yl)phenyl]-N-[4-(4-trimethylsilylphenyl)phenyl]benzo[b][1]benzosilol-2-amine (PubChem CID 90195239) has the molecular formula C63H50N2Si2 and a molecular weight of 891.28 g/mol. Its IUPAC name is 5,5-diphenyl-N-[4-(9-phenylcarbazol-3-yl)phenyl]-N-[4-(4-trimethylsilylphenyl)phenyl]benzo[b][1]benzosilol-2-amine.
| Compound Name | 5,5-diphenyl-N-[4-(9-phenylcarbazol-3-yl)phenyl]-N-[4-(4-trimethylsilylphenyl)phenyl]benzo[b][1]benzosilol-2-amine |
|---|---|
| PubChem CID | 90195239 |
| Molecular Formula | C63H50N2Si2 |
| Molecular Weight | 891.28 g/mol |
| Exact Mass | 890.35 |
| IUPAC Name | 5,5-diphenyl-N-[4-(9-phenylcarbazol-3-yl)phenyl]-N-[4-(4-trimethylsilylphenyl)phenyl]benzo[b][1]benzosilol-2-amine |
| SMILES | C[Si](C)(C)c1ccc(-c2ccc(N(c3ccc(-c4ccc5c(c4)c4ccccc4n5-c4ccccc4)cc3)c3ccc4c(c3)-c3ccccc3[Si]4(c3ccccc3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C63H50N2Si2/c1-66(2,3)53-39-31-46(32-40-53)45-27-34-50(35-28-45)64(51-36-29-47(30-37-51)48-33-41-61-58(43-48)56-23-13-15-25-60(56)65(61)49-17-7-4-8-18-49)52-38-42-63-59(44-52)57-24-14-16-26-62(57)67(63,54-19-9-5-10-20-54)55-21-11-6-12-22-55/h4-44H,1-3H3 |
| InChIKey | SUUHWYVCIHHYHQ-UHFFFAOYSA-N |
| XLogP | 13.49 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 891.28 |
| LogP ≤ 5 | 13.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|