C9H12FN3O2S — CID 90205281
4-(1,1-dioxo-1,4-thiazinan-4-yl)-5-fluoropyridin-3-amine (PubChem CID 90205281) has the molecular formula C9H12FN3O2S and a molecular weight of 245.28 g/mol. Its IUPAC name is 4-(1,1-dioxo-1,4-thiazinan-4-yl)-5-fluoropyridin-3-amine.
| Compound Name | 4-(1,1-dioxo-1,4-thiazinan-4-yl)-5-fluoropyridin-3-amine |
|---|---|
| PubChem CID | 90205281 |
| Molecular Formula | C9H12FN3O2S |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 4-(1,1-dioxo-1,4-thiazinan-4-yl)-5-fluoropyridin-3-amine |
| SMILES | Nc1cncc(F)c1N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C9H12FN3O2S/c10-7-5-12-6-8(11)9(7)13-1-3-16(14,15)4-2-13/h5-6H,1-4,11H2 |
| InChIKey | ULIRSGIFHBNGLX-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |