C22H29F3NO3PS — CID 90218421
3-[[4-(5-phenylpentylsulfanyl)-2-(trifluoromethyl)phenyl]methylamino]propylphosphonic acid (PubChem CID 90218421) has the molecular formula C22H29F3NO3PS and a molecular weight of 475.51 g/mol. Its IUPAC name is 3-[[4-(5-phenylpentylsulfanyl)-2-(trifluoromethyl)phenyl]methylamino]propylphosphonic acid.
| Compound Name | 3-[[4-(5-phenylpentylsulfanyl)-2-(trifluoromethyl)phenyl]methylamino]propylphosphonic acid |
|---|---|
| PubChem CID | 90218421 |
| Molecular Formula | C22H29F3NO3PS |
| Molecular Weight | 475.51 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | 3-[[4-(5-phenylpentylsulfanyl)-2-(trifluoromethyl)phenyl]methylamino]propylphosphonic acid |
| SMILES | O=P(O)(O)CCCNCc1ccc(SCCCCCc2ccccc2)cc1C(F)(F)F |
| InChI | InChI=1S/C22H29F3NO3PS/c23-22(24,25)21-16-20(12-11-19(21)17-26-13-7-14-30(27,28)29)31-15-6-2-5-10-18-8-3-1-4-9-18/h1,3-4,8-9,11-12,16,26H,2,5-7,10,13-15,17H2,(H2,27,28,29) |
| InChIKey | BXSBBAAAIXYSJW-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.51 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|