C34H42N3O4S+ — CID 90219515
4-(4-benzoylphenoxy)butyl-[3-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]propyl]-dimethylazanium (PubChem CID 90219515) has the molecular formula C34H42N3O4S+ and a molecular weight of 588.79 g/mol. Its IUPAC name is 4-(4-benzoylphenoxy)butyl-[3-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]propyl]-dimethylazanium.
| Compound Name | 4-(4-benzoylphenoxy)butyl-[3-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]propyl]-dimethylazanium |
|---|---|
| PubChem CID | 90219515 |
| Molecular Formula | C34H42N3O4S+ |
| Molecular Weight | 588.79 g/mol |
| Exact Mass | 588.29 |
| IUPAC Name | 4-(4-benzoylphenoxy)butyl-[3-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]propyl]-dimethylazanium |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)NCCC[N+](C)(C)CCCCOc3ccc(C(=O)c4ccccc4)cc3)cccc12 |
| InChI | InChI=1S/C34H42N3O4S/c1-36(2)32-17-10-16-31-30(32)15-11-18-33(31)42(39,40)35-23-12-25-37(3,4)24-8-9-26-41-29-21-19-28(20-22-29)34(38)27-13-6-5-7-14-27/h5-7,10-11,13-22,35H,8-9,12,23-26H2,1-4H3/q+1 |
| InChIKey | YQHUZVJTGJXBSY-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.79 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|