C38H28F10N2O7S — CID 10509754
bis(2,3,4,5,6-pentafluorophenyl) 5-[6-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]hexoxy]benzene-1,3-dicarboxylate (PubChem CID 10509754) has the molecular formula C38H28F10N2O7S and a molecular weight of 846.70 g/mol. Its IUPAC name is bis(2,3,4,5,6-pentafluorophenyl) 5-[6-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]hexoxy]benzene-1,3-dicarboxylate.
| Compound Name | bis(2,3,4,5,6-pentafluorophenyl) 5-[6-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]hexoxy]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 10509754 |
| Molecular Formula | C38H28F10N2O7S |
| Molecular Weight | 846.70 g/mol |
| Exact Mass | 846.15 |
| IUPAC Name | bis(2,3,4,5,6-pentafluorophenyl) 5-[6-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]hexoxy]benzene-1,3-dicarboxylate |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)NCCCCCCOc3cc(C(=O)Oc4c(F)c(F)c(F)c(F)c4F)cc(C(=O)Oc4c(F)c(F)c(F)c(F)c4F)c3)cccc12 |
| InChI | InChI=1S/C38H28F10N2O7S/c1-50(2)23-11-7-10-22-21(23)9-8-12-24(22)58(53,54)49-13-5-3-4-6-14-55-20-16-18(37(51)56-35-31(45)27(41)25(39)28(42)32(35)46)15-19(17-20)38(52)57-36-33(47)29(43)26(40)30(44)34(36)48/h7-12,15-17,49H,3-6,13-14H2,1-2H3 |
| InChIKey | BTIBSWPQYQKIIG-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 846.70 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|