C23H34N3O4S+ — CID 126639105
3-(4-benzoylphenoxy)propyl-[3-(dimethylsulfamoylamino)propyl]-dimethylazanium (PubChem CID 126639105) has the molecular formula C23H34N3O4S+ and a molecular weight of 448.61 g/mol. Its IUPAC name is 3-(4-benzoylphenoxy)propyl-[3-(dimethylsulfamoylamino)propyl]-dimethylazanium.
| Compound Name | 3-(4-benzoylphenoxy)propyl-[3-(dimethylsulfamoylamino)propyl]-dimethylazanium |
|---|---|
| PubChem CID | 126639105 |
| Molecular Formula | C23H34N3O4S+ |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | 3-(4-benzoylphenoxy)propyl-[3-(dimethylsulfamoylamino)propyl]-dimethylazanium |
| SMILES | CN(C)S(=O)(=O)NCCC[N+](C)(C)CCCOc1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H34N3O4S/c1-25(2)31(28,29)24-16-8-17-26(3,4)18-9-19-30-22-14-12-21(13-15-22)23(27)20-10-6-5-7-11-20/h5-7,10-15,24H,8-9,16-19H2,1-4H3/q+1 |
| InChIKey | HUUSFPKDYXHSIU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|