C30H38BrN2O4S- — CID 126622071
2-[3-[3-(4-benzoylphenoxy)propyl-dimethylazaniumyl]propyl-sulfinatoamino]-1,3,5-trimethylbenzene bromide (PubChem CID 126622071) has the molecular formula C30H38BrN2O4S- and a molecular weight of 602.62 g/mol. Its IUPAC name is 2-[3-[3-(4-benzoylphenoxy)propyl-dimethylazaniumyl]propyl-sulfinatoamino]-1,3,5-trimethylbenzene bromide.
| Compound Name | 2-[3-[3-(4-benzoylphenoxy)propyl-dimethylazaniumyl]propyl-sulfinatoamino]-1,3,5-trimethylbenzene bromide |
|---|---|
| PubChem CID | 126622071 |
| Molecular Formula | C30H38BrN2O4S- |
| Molecular Weight | 602.62 g/mol |
| Exact Mass | 601.17 |
| IUPAC Name | 2-[3-[3-(4-benzoylphenoxy)propyl-dimethylazaniumyl]propyl-sulfinatoamino]-1,3,5-trimethylbenzene bromide |
| SMILES | Cc1cc(C)c(N(CCC[N+](C)(C)CCCOc2ccc(C(=O)c3ccccc3)cc2)S(=O)[O-])c(C)c1.[Br-] |
| InChI | InChI=1S/C30H38N2O4S.BrH/c1-23-21-24(2)29(25(3)22-23)31(37(34)35)17-9-18-32(4,5)19-10-20-36-28-15-13-27(14-16-28)30(33)26-11-7-6-8-12-26;/h6-8,11-16,21-22H,9-10,17-20H2,1-5H3;1H/p-1 |
| InChIKey | WGVKROHLYFDOKE-UHFFFAOYSA-M |
| XLogP | 2.38 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.62 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|