C30H34N6O3 — CID 90221865
tert-butyl 4-[8-carbamoyl-6-[3-methanimidoyl-4-(methylamino)phenyl]-9H-carbazol-2-yl]piperazine-1-carboxylate (PubChem CID 90221865) has the molecular formula C30H34N6O3 and a molecular weight of 526.64 g/mol. Its IUPAC name is tert-butyl 4-[8-carbamoyl-6-[3-methanimidoyl-4-(methylamino)phenyl]-9H-carbazol-2-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[8-carbamoyl-6-[3-methanimidoyl-4-(methylamino)phenyl]-9H-carbazol-2-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 90221865 |
| Molecular Formula | C30H34N6O3 |
| Molecular Weight | 526.64 g/mol |
| Exact Mass | 526.27 |
| IUPAC Name | tert-butyl 4-[8-carbamoyl-6-[3-methanimidoyl-4-(methylamino)phenyl]-9H-carbazol-2-yl]piperazine-1-carboxylate |
| SMILES | [H]/N=C/c1cc(-c2cc(C(N)=O)c3[nH]c4cc(N5CCN(C(=O)OC(C)(C)C)CC5)ccc4c3c2)ccc1NC |
| InChI | InChI=1S/C30H34N6O3/c1-30(2,3)39-29(38)36-11-9-35(10-12-36)21-6-7-22-23-14-19(18-5-8-25(33-4)20(13-18)17-31)15-24(28(32)37)27(23)34-26(22)16-21/h5-8,13-17,31,33-34H,9-12H2,1-4H3,(H2,32,37)/b31-17+ |
| InChIKey | GPRHCTPKIXNTGY-KBVAKVRCSA-N |
| XLogP | 5.18 |
| TPSA | 127.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.64 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|