C30H46F3N7O6 — CID 90222613
tert-butyl 4-[2-[5-[[ethylamino-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]amino]pentanoylamino]-6-formamido-4-(trifluoromethyl)phenyl]piperazine-1-carboxylate (PubChem CID 90222613) has the molecular formula C30H46F3N7O6 and a molecular weight of 657.74 g/mol. Its IUPAC name is tert-butyl 4-[2-[5-[[ethylamino-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]amino]pentanoylamino]-6-formamido-4-(trifluoromethyl)phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[5-[[ethylamino-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]amino]pentanoylamino]-6-formamido-4-(trifluoromethyl)phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 90222613 |
| Molecular Formula | C30H46F3N7O6 |
| Molecular Weight | 657.74 g/mol |
| Exact Mass | 657.35 |
| IUPAC Name | tert-butyl 4-[2-[5-[[ethylamino-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]amino]pentanoylamino]-6-formamido-4-(trifluoromethyl)phenyl]piperazine-1-carboxylate |
| SMILES | CCN/C(=N\CCCCC(=O)Nc1cc(C(F)(F)F)cc(NC=O)c1N1CCN(C(=O)OC(C)(C)C)CC1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H46F3N7O6/c1-8-34-25(38-26(43)45-28(2,3)4)35-12-10-9-11-23(42)37-22-18-20(30(31,32)33)17-21(36-19-41)24(22)39-13-15-40(16-14-39)27(44)46-29(5,6)7/h17-19H,8-16H2,1-7H3,(H,36,41)(H,37,42)(H2,34,35,38,43) |
| InChIKey | ITJBHFLQMCKFNZ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 153.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.74 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|