C18H14F3N3O3 — CID 90236714
3-[5,8-difluoro-3-(3-fluorophenyl)-4-oxoquinazolin-2-yl]propylcarbamic acid (PubChem CID 90236714) has the molecular formula C18H14F3N3O3 and a molecular weight of 377.32 g/mol. Its IUPAC name is 3-[5,8-difluoro-3-(3-fluorophenyl)-4-oxoquinazolin-2-yl]propylcarbamic acid.
| Compound Name | 3-[5,8-difluoro-3-(3-fluorophenyl)-4-oxoquinazolin-2-yl]propylcarbamic acid |
|---|---|
| PubChem CID | 90236714 |
| Molecular Formula | C18H14F3N3O3 |
| Molecular Weight | 377.32 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | 3-[5,8-difluoro-3-(3-fluorophenyl)-4-oxoquinazolin-2-yl]propylcarbamic acid |
| SMILES | O=C(O)NCCCc1nc2c(F)ccc(F)c2c(=O)n1-c1cccc(F)c1 |
| InChI | InChI=1S/C18H14F3N3O3/c19-10-3-1-4-11(9-10)24-14(5-2-8-22-18(26)27)23-16-13(21)7-6-12(20)15(16)17(24)25/h1,3-4,6-7,9,22H,2,5,8H2,(H,26,27) |
| InChIKey | PKXAQVREMHQSPZ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.32 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|