C23H25FN4O2 — CID 90237473
2-cyclopropyl-6-fluoro-7-methoxy-4-[4-(2-methoxyphenyl)piperazin-1-yl]quinazoline (PubChem CID 90237473) has the molecular formula C23H25FN4O2 and a molecular weight of 408.48 g/mol. Its IUPAC name is 2-cyclopropyl-6-fluoro-7-methoxy-4-[4-(2-methoxyphenyl)piperazin-1-yl]quinazoline.
| Compound Name | 2-cyclopropyl-6-fluoro-7-methoxy-4-[4-(2-methoxyphenyl)piperazin-1-yl]quinazoline |
|---|---|
| PubChem CID | 90237473 |
| Molecular Formula | C23H25FN4O2 |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 2-cyclopropyl-6-fluoro-7-methoxy-4-[4-(2-methoxyphenyl)piperazin-1-yl]quinazoline |
| SMILES | COc1cc2nc(C3CC3)nc(N3CCN(c4ccccc4OC)CC3)c2cc1F |
| InChI | InChI=1S/C23H25FN4O2/c1-29-20-6-4-3-5-19(20)27-9-11-28(12-10-27)23-16-13-17(24)21(30-2)14-18(16)25-22(26-23)15-7-8-15/h3-6,13-15H,7-12H2,1-2H3 |
| InChIKey | ACGNRJGRDMUEKJ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 50.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |