About 2-cyclopropyl-6,7-dimethoxy-4-[4-(4-methoxy-2-nitrophenyl)piperazin-1-yl]quinazoline
2-cyclopropyl-6,7-dimethoxy-4-[4-(4-methoxy-2-nitrophenyl)piperazin-1-yl]quinazoline (PubChem CID 76900716) has the molecular formula C24H27N5O5
and a molecular weight of 465.51 g/mol. Its IUPAC name is 2-cyclopropyl-6,7-dimethoxy-4-[4-(4-methoxy-2-nitrophenyl)piperazin-1-yl]quinazoline.
Molecular Properties
| Compound Name | 2-cyclopropyl-6,7-dimethoxy-4-[4-(4-methoxy-2-nitrophenyl)piperazin-1-yl]quinazoline |
| PubChem CID | 76900716 |
| Molecular Formula | C24H27N5O5 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | 2-cyclopropyl-6,7-dimethoxy-4-[4-(4-methoxy-2-nitrophenyl)piperazin-1-yl]quinazoline |
| SMILES | COc1ccc(N2CCN(c3nc(C4CC4)nc4cc(OC)c(OC)cc34)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H27N5O5/c1-32-16-6-7-19(20(12-16)29(30)31)27-8-10-28(11-9-27)24-17-13-21(33-2)22(34-3)14-18(17)25-23(26-24)15-4-5-15/h6-7,12-15H,4-5,8-11H2,1-3H3 |
| InChIKey | DEBSLCPUWLPWJL-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 103.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclopropyl-6,7-dimethoxy-4-[4-(4-methoxy-2-nitrophenyl)piperazin-1-yl]quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-6,7-dimethoxy-4-[4-(4-methoxy-2-nitrophenyl)piperazin-1-yl]quinazoline?
The IUPAC name of 2-cyclopropyl-6,7-dimethoxy-4-[4-(4-methoxy-2-nitrophenyl)piperazin-1-yl]quinazoline (CID 76900716) is 2-cyclopropyl-6,7-dimethoxy-4-[4-(4-methoxy-2-nitrophenyl)piperazin-1-yl]quinazoline.
What is the SMILES notation for 2-cyclopropyl-6,7-dimethoxy-4-[4-(4-methoxy-2-nitrophenyl)piperazin-1-yl]quinazoline?
The canonical SMILES for 2-cyclopropyl-6,7-dimethoxy-4-[4-(4-methoxy-2-nitrophenyl)piperazin-1-yl]quinazoline is COc1ccc(N2CCN(c3nc(C4CC4)nc4cc(OC)c(OC)cc34)CC2)c([N+](=O)[O-])c1.
What is the InChIKey of 2-cyclopropyl-6,7-dimethoxy-4-[4-(4-methoxy-2-nitrophenyl)piperazin-1-yl]quinazoline?
The InChIKey is DEBSLCPUWLPWJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27N5O5/c1-32-16-6-7-19(20(12-16)29(30)31)27-8-10-28(11-9-27)24-17-13-21(33-2)22(34-3)14-18(17)25-23(26-24)15-4-5-15/h6-7,12-15H,4-5,8-11H2,1-3H3.
What are the key properties of 2-cyclopropyl-6,7-dimethoxy-4-[4-(4-methoxy-2-nitrophenyl)piperazin-1-yl]quinazoline?
2-cyclopropyl-6,7-dimethoxy-4-[4-(4-methoxy-2-nitrophenyl)piperazin-1-yl]quinazoline has a molecular weight of 465.51 g/mol, XLogP of 3.77, 7 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-6,7-dimethoxy-4-[4-(4-methoxy-2-nitrophenyl)piperazin-1-yl]quinazoline is sourced from PubChem (CID 76900716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).