C37H39F2NO11 — CID 90251145
[2,7-bis[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]spiro[fluorene-9,4'-piperidine]-1'-yl]-(2,2-difluorocyclopropyl)methanone (PubChem CID 90251145) has the molecular formula C37H39F2NO11 and a molecular weight of 711.71 g/mol. Its IUPAC name is [2,7-bis[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]spiro[fluorene-9,4'-piperidine]-1'-yl]-(2,2-difluorocyclopropyl)methanone.
| Compound Name | [2,7-bis[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]spiro[fluorene-9,4'-piperidine]-1'-yl]-(2,2-difluorocyclopropyl)methanone |
|---|---|
| PubChem CID | 90251145 |
| Molecular Formula | C37H39F2NO11 |
| Molecular Weight | 711.71 g/mol |
| Exact Mass | 711.25 |
| IUPAC Name | [2,7-bis[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]spiro[fluorene-9,4'-piperidine]-1'-yl]-(2,2-difluorocyclopropyl)methanone |
| SMILES | O=C(C1CC1(F)F)N1CCC2(CC1)c1cc(C#C[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)ccc1-c1ccc(C#C[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)cc12 |
| InChI | InChI=1S/C37H39F2NO11/c38-37(39)15-24(37)35(49)40-11-9-36(10-12-40)22-13-18(3-7-25-29(43)33(47)31(45)27(16-41)50-25)1-5-20(22)21-6-2-19(14-23(21)36)4-8-26-30(44)34(48)32(46)28(17-42)51-26/h1-2,5-6,13-14,24-34,41-48H,9-12,15-17H2/t24?,25-,26-,27-,28-,29-,30-,31-,32-,33-,34-/m1/s1 |
| InChIKey | BSZYNONIYIIMRW-AVLWMRLQSA-N |
| XLogP | -1.38 |
| TPSA | 200.61 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.71 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|