C30H31F2NO6 — CID 155076144
(2,2-difluorocyclopropyl)-[2-methyl-7-[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]spiro[fluorene-9,4'-piperidine]-1'-yl]methanone (PubChem CID 155076144) has the molecular formula C30H31F2NO6 and a molecular weight of 539.58 g/mol. Its IUPAC name is (2,2-difluorocyclopropyl)-[2-methyl-7-[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]spiro[fluorene-9,4'-piperidine]-1'-yl]methanone.
| Compound Name | (2,2-difluorocyclopropyl)-[2-methyl-7-[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]spiro[fluorene-9,4'-piperidine]-1'-yl]methanone |
|---|---|
| PubChem CID | 155076144 |
| Molecular Formula | C30H31F2NO6 |
| Molecular Weight | 539.58 g/mol |
| Exact Mass | 539.21 |
| IUPAC Name | (2,2-difluorocyclopropyl)-[2-methyl-7-[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]spiro[fluorene-9,4'-piperidine]-1'-yl]methanone |
| SMILES | Cc1ccc2c(c1)C1(CCN(C(=O)C3CC3(F)F)CC1)c1cc(C#C[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)ccc1-2 |
| InChI | InChI=1S/C30H31F2NO6/c1-16-2-5-18-19-6-3-17(4-7-23-25(35)27(37)26(36)24(15-34)39-23)13-21(19)29(20(18)12-16)8-10-33(11-9-29)28(38)22-14-30(22,31)32/h2-3,5-6,12-13,22-27,34-37H,8-11,14-15H2,1H3/t22?,23-,24-,25-,26-,27-/m1/s1 |
| InChIKey | OIRRZYXUHOQCMC-ZUPKLBQESA-N |
| XLogP | 1.73 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.58 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|