C24H22N2O2 — CID 90254236
12,12,14,14-tetramethyl-8-phenyl-13-oxa-10,17-diazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(17),2,4,6,8,11(15)-hexaen-16-one (PubChem CID 90254236) has the molecular formula C24H22N2O2 and a molecular weight of 370.45 g/mol. Its IUPAC name is 12,12,14,14-tetramethyl-8-phenyl-13-oxa-10,17-diazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(17),2,4,6,8,11(15)-hexaen-16-one.
| Compound Name | 12,12,14,14-tetramethyl-8-phenyl-13-oxa-10,17-diazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(17),2,4,6,8,11(15)-hexaen-16-one |
|---|---|
| PubChem CID | 90254236 |
| Molecular Formula | C24H22N2O2 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 12,12,14,14-tetramethyl-8-phenyl-13-oxa-10,17-diazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(17),2,4,6,8,11(15)-hexaen-16-one |
| SMILES | CC1(C)OC(C)(C)c2c1c(=O)nc1c3ccccc3c(-c3ccccc3)cn21 |
| InChI | InChI=1S/C24H22N2O2/c1-23(2)19-20(24(3,4)28-23)26-14-18(15-10-6-5-7-11-15)16-12-8-9-13-17(16)21(26)25-22(19)27/h5-14H,1-4H3 |
| InChIKey | GJUWTCSWLJKWCY-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|