C15H11F6N3O2 — CID 9026444
N-[(Z)-[4-[(2S)-1,1,2,3,3,3-hexafluoropropoxy]phenyl]methylideneamino]-1H-pyrrole-2-carboxamide (PubChem CID 9026444) has the molecular formula C15H11F6N3O2 and a molecular weight of 379.26 g/mol. Its IUPAC name is N-[(Z)-[4-[(2S)-1,1,2,3,3,3-hexafluoropropoxy]phenyl]methylideneamino]-1H-pyrrole-2-carboxamide.
| Compound Name | N-[(Z)-[4-[(2S)-1,1,2,3,3,3-hexafluoropropoxy]phenyl]methylideneamino]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 9026444 |
| Molecular Formula | C15H11F6N3O2 |
| Molecular Weight | 379.26 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | N-[(Z)-[4-[(2S)-1,1,2,3,3,3-hexafluoropropoxy]phenyl]methylideneamino]-1H-pyrrole-2-carboxamide |
| SMILES | O=C(N/N=C\c1ccc(OC(F)(F)[C@H](F)C(F)(F)F)cc1)c1ccc[nH]1 |
| InChI | InChI=1S/C15H11F6N3O2/c16-13(14(17,18)19)15(20,21)26-10-5-3-9(4-6-10)8-23-24-12(25)11-2-1-7-22-11/h1-8,13,22H,(H,24,25)/b23-8-/t13-/m1/s1 |
| InChIKey | IJSXUMVQAAIHBB-OZRRKWFZSA-N |
| XLogP | 3.65 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.26 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|