C26H29N3O5S — CID 90274382
butyl N-[4-methyl-3-[[4-(4-methylphenyl)sulfonylphenyl]carbamoylamino]phenyl]carbamate (PubChem CID 90274382) has the molecular formula C26H29N3O5S and a molecular weight of 495.60 g/mol. Its IUPAC name is butyl N-[4-methyl-3-[[4-(4-methylphenyl)sulfonylphenyl]carbamoylamino]phenyl]carbamate.
| Compound Name | butyl N-[4-methyl-3-[[4-(4-methylphenyl)sulfonylphenyl]carbamoylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 90274382 |
| Molecular Formula | C26H29N3O5S |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | butyl N-[4-methyl-3-[[4-(4-methylphenyl)sulfonylphenyl]carbamoylamino]phenyl]carbamate |
| SMILES | CCCCOC(=O)Nc1ccc(C)c(NC(=O)Nc2ccc(S(=O)(=O)c3ccc(C)cc3)cc2)c1 |
| InChI | InChI=1S/C26H29N3O5S/c1-4-5-16-34-26(31)28-21-9-8-19(3)24(17-21)29-25(30)27-20-10-14-23(15-11-20)35(32,33)22-12-6-18(2)7-13-22/h6-15,17H,4-5,16H2,1-3H3,(H,28,31)(H2,27,29,30) |
| InChIKey | IQHPMQAUYRBIJD-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|