C30H35B2NO7P — CID 90276863
CID 90276863 (PubChem CID 90276863) has the molecular formula C30H35B2NO7P and a molecular weight of 574.21 g/mol.
| Compound Name | CID 90276863 |
|---|---|
| PubChem CID | 90276863 |
| Molecular Formula | C30H35B2NO7P |
| Molecular Weight | 574.21 g/mol |
| Exact Mass | 574.23 |
| IUPAC Name | — |
| SMILES | CC1[C@@H](OCN(Cc2ccccc2)C(=O)OCc2ccccc2)OC(COCc2ccccc2)[C@@H](O)[C@@H]1P[B]B=O |
| InChI | InChI=1S/C30H35B2NO7P/c1-22-28(41-32-31-36)27(34)26(20-37-18-24-13-7-3-8-14-24)40-29(22)39-21-33(17-23-11-5-2-6-12-23)30(35)38-19-25-15-9-4-10-16-25/h2-16,22,26-29,34,41H,17-21H2,1H3/t22?,26?,27-,28-,29+/m1/s1 |
| InChIKey | YOHOKOFLWDCKTP-FGLWFXMYSA-N |
| XLogP | 4.37 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.21 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|