C17H22ClN5O2 — CID 90284494
3-methyl-15-(3-methylazetidin-3-yl)-9-oxa-2,5,6,15-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),6,11,16-tetraen-4-one;hydrochloride (PubChem CID 90284494) has the molecular formula C17H22ClN5O2 and a molecular weight of 363.85 g/mol. Its IUPAC name is 3-methyl-15-(3-methylazetidin-3-yl)-9-oxa-2,5,6,15-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),6,11,16-tetraen-4-one;hydrochloride.
| Compound Name | 3-methyl-15-(3-methylazetidin-3-yl)-9-oxa-2,5,6,15-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),6,11,16-tetraen-4-one;hydrochloride |
|---|---|
| PubChem CID | 90284494 |
| Molecular Formula | C17H22ClN5O2 |
| Molecular Weight | 363.85 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 3-methyl-15-(3-methylazetidin-3-yl)-9-oxa-2,5,6,15-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),6,11,16-tetraen-4-one;hydrochloride |
| SMILES | CC1C(=O)NN=C2COc3cc4c(cc3N21)N(C1(C)CNC1)CC4.Cl |
| InChI | InChI=1S/C17H21N5O2.ClH/c1-10-16(23)20-19-15-7-24-14-5-11-3-4-21(17(2)8-18-9-17)12(11)6-13(14)22(10)15;/h5-6,10,18H,3-4,7-9H2,1-2H3,(H,20,23);1H |
| InChIKey | SXIVJFAORNIMHI-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.85 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|