C14H25NO3 — CID 90285006
2-(2,2,6,6-tetramethylpiperidin-4-yl)ethyl prop-2-eneperoxoate (PubChem CID 90285006) has the molecular formula C14H25NO3 and a molecular weight of 255.36 g/mol. Its IUPAC name is 2-(2,2,6,6-tetramethylpiperidin-4-yl)ethyl prop-2-eneperoxoate.
| Compound Name | 2-(2,2,6,6-tetramethylpiperidin-4-yl)ethyl prop-2-eneperoxoate |
|---|---|
| PubChem CID | 90285006 |
| Molecular Formula | C14H25NO3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | 2-(2,2,6,6-tetramethylpiperidin-4-yl)ethyl prop-2-eneperoxoate |
| SMILES | C=CC(=O)OOCCC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C14H25NO3/c1-6-12(16)18-17-8-7-11-9-13(2,3)15-14(4,5)10-11/h6,11,15H,1,7-10H2,2-5H3 |
| InChIKey | MDPDZVQPGLGIHB-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|