C18H21ClF4O3 — CID 90296477
2-[[3-chloro-5-fluoro-4-[(E)-3-fluoroprop-1-enoxy]phenoxy]-difluoromethyl]-5-propyloxane (PubChem CID 90296477) has the molecular formula C18H21ClF4O3 and a molecular weight of 396.81 g/mol. Its IUPAC name is 2-[[3-chloro-5-fluoro-4-[(E)-3-fluoroprop-1-enoxy]phenoxy]-difluoromethyl]-5-propyloxane.
| Compound Name | 2-[[3-chloro-5-fluoro-4-[(E)-3-fluoroprop-1-enoxy]phenoxy]-difluoromethyl]-5-propyloxane |
|---|---|
| PubChem CID | 90296477 |
| Molecular Formula | C18H21ClF4O3 |
| Molecular Weight | 396.81 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 2-[[3-chloro-5-fluoro-4-[(E)-3-fluoroprop-1-enoxy]phenoxy]-difluoromethyl]-5-propyloxane |
| SMILES | CCCC1CCC(C(F)(F)Oc2cc(F)c(O/C=C/CF)c(Cl)c2)OC1 |
| InChI | InChI=1S/C18H21ClF4O3/c1-2-4-12-5-6-16(25-11-12)18(22,23)26-13-9-14(19)17(15(21)10-13)24-8-3-7-20/h3,8-10,12,16H,2,4-7,11H2,1H3/b8-3+ |
| InChIKey | TUCVKOSXILSJDO-FPYGCLRLSA-N |
| XLogP | 5.91 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.81 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|