C20H20N2O7S2 — CID 90299808
4-[[1-[[1-(4-carboxyphenoxy)-1-oxo-3-sulfanylpropan-2-yl]amino]-1-oxo-3-sulfanylpropan-2-yl]amino]benzoic acid (PubChem CID 90299808) has the molecular formula C20H20N2O7S2 and a molecular weight of 464.52 g/mol. Its IUPAC name is 4-[[1-[[1-(4-carboxyphenoxy)-1-oxo-3-sulfanylpropan-2-yl]amino]-1-oxo-3-sulfanylpropan-2-yl]amino]benzoic acid.
| Compound Name | 4-[[1-[[1-(4-carboxyphenoxy)-1-oxo-3-sulfanylpropan-2-yl]amino]-1-oxo-3-sulfanylpropan-2-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 90299808 |
| Molecular Formula | C20H20N2O7S2 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.07 |
| IUPAC Name | 4-[[1-[[1-(4-carboxyphenoxy)-1-oxo-3-sulfanylpropan-2-yl]amino]-1-oxo-3-sulfanylpropan-2-yl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(NC(CS)C(=O)NC(CS)C(=O)Oc2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C20H20N2O7S2/c23-17(15(9-30)21-13-5-1-11(2-6-13)18(24)25)22-16(10-31)20(28)29-14-7-3-12(4-8-14)19(26)27/h1-8,15-16,21,30-31H,9-10H2,(H,22,23)(H,24,25)(H,26,27) |
| InChIKey | IGKLIBPVWRSYAC-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 142.03 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|