C12H25NOS — CID 90309997
(R)-2-methyl-N-(6-methylhept-5-en-2-yl)propane-2-sulfinamide (PubChem CID 90309997) has the molecular formula C12H25NOS and a molecular weight of 231.40 g/mol. Its IUPAC name is (R)-2-methyl-N-(6-methylhept-5-en-2-yl)propane-2-sulfinamide.
| Compound Name | (R)-2-methyl-N-(6-methylhept-5-en-2-yl)propane-2-sulfinamide |
|---|---|
| PubChem CID | 90309997 |
| Molecular Formula | C12H25NOS |
| Molecular Weight | 231.40 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | (R)-2-methyl-N-(6-methylhept-5-en-2-yl)propane-2-sulfinamide |
| SMILES | CC(C)=CCCC(C)N[S@](=O)C(C)(C)C |
| InChI | InChI=1S/C12H25NOS/c1-10(2)8-7-9-11(3)13-15(14)12(4,5)6/h8,11,13H,7,9H2,1-6H3/t11?,15-/m1/s1 |
| InChIKey | KMMPDUACLOLOSN-JOPIAHFSSA-N |
| XLogP | 3.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.40 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|