About 2,5-di(propan-2-yl)-3H-thieno[2,3-d][1,2]thiazole 1,1-dioxide
2,5-di(propan-2-yl)-3H-thieno[2,3-d][1,2]thiazole 1,1-dioxide (PubChem CID 90310288) has the molecular formula C11H17NO2S2
and a molecular weight of 259.40 g/mol. Its IUPAC name is 2,5-di(propan-2-yl)-3H-thieno[2,3-d][1,2]thiazole 1,1-dioxide.
Analyze 2,5-di(propan-2-yl)-3H-thieno[2,3-d][1,2]thiazole 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-di(propan-2-yl)-3H-thieno[2,3-d][1,2]thiazole 1,1-dioxide?
The IUPAC name of 2,5-di(propan-2-yl)-3H-thieno[2,3-d][1,2]thiazole 1,1-dioxide (CID 90310288) is 2,5-di(propan-2-yl)-3H-thieno[2,3-d][1,2]thiazole 1,1-dioxide.
What is the SMILES notation for 2,5-di(propan-2-yl)-3H-thieno[2,3-d][1,2]thiazole 1,1-dioxide?
The canonical SMILES for 2,5-di(propan-2-yl)-3H-thieno[2,3-d][1,2]thiazole 1,1-dioxide is CC(C)c1cc2c(s1)CN(C(C)C)S2(=O)=O.
What is the InChIKey of 2,5-di(propan-2-yl)-3H-thieno[2,3-d][1,2]thiazole 1,1-dioxide?
The InChIKey is SMZDIHJDCZPKTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO2S2/c1-7(2)9-5-11-10(15-9)6-12(8(3)4)16(11,13)14/h5,7-8H,6H2,1-4H3.
What are the key properties of 2,5-di(propan-2-yl)-3H-thieno[2,3-d][1,2]thiazole 1,1-dioxide?
2,5-di(propan-2-yl)-3H-thieno[2,3-d][1,2]thiazole 1,1-dioxide has a molecular weight of 259.40 g/mol, XLogP of 2.78, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-di(propan-2-yl)-3H-thieno[2,3-d][1,2]thiazole 1,1-dioxide is sourced from PubChem (CID 90310288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).