C16H28O4 — CID 90311432
2-(4-ethyl-6-methyl-4-propan-2-ylheptan-3-ylidene)propanedioic acid (PubChem CID 90311432) has the molecular formula C16H28O4 and a molecular weight of 284.40 g/mol. Its IUPAC name is 2-(4-ethyl-6-methyl-4-propan-2-ylheptan-3-ylidene)propanedioic acid.
| Compound Name | 2-(4-ethyl-6-methyl-4-propan-2-ylheptan-3-ylidene)propanedioic acid |
|---|---|
| PubChem CID | 90311432 |
| Molecular Formula | C16H28O4 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 2-(4-ethyl-6-methyl-4-propan-2-ylheptan-3-ylidene)propanedioic acid |
| SMILES | CCC(=C(C(=O)O)C(=O)O)C(CC)(CC(C)C)C(C)C |
| InChI | InChI=1S/C16H28O4/c1-7-12(13(14(17)18)15(19)20)16(8-2,11(5)6)9-10(3)4/h10-11H,7-9H2,1-6H3,(H,17,18)(H,19,20) |
| InChIKey | JKDXRMWTGKCKIN-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|