C17H30O4 — CID 90311199
2-[2,2-diethyl-4-methyl-1-(2-methylpropyl)pentylidene]propanedioic acid (PubChem CID 90311199) has the molecular formula C17H30O4 and a molecular weight of 298.42 g/mol. Its IUPAC name is 2-[2,2-diethyl-4-methyl-1-(2-methylpropyl)pentylidene]propanedioic acid.
| Compound Name | 2-[2,2-diethyl-4-methyl-1-(2-methylpropyl)pentylidene]propanedioic acid |
|---|---|
| PubChem CID | 90311199 |
| Molecular Formula | C17H30O4 |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | 2-[2,2-diethyl-4-methyl-1-(2-methylpropyl)pentylidene]propanedioic acid |
| SMILES | CCC(CC)(CC(C)C)C(CC(C)C)=C(C(=O)O)C(=O)O |
| InChI | InChI=1S/C17H30O4/c1-7-17(8-2,10-12(5)6)13(9-11(3)4)14(15(18)19)16(20)21/h11-12H,7-10H2,1-6H3,(H,18,19)(H,20,21) |
| InChIKey | XRIATWKQSCFWFF-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|