C9H14O3 — CID 90321322
(2Z,4E)-6-ethoxy-2-hydroxy-5-methylhexa-2,4-dienal (PubChem CID 90321322) has the molecular formula C9H14O3 and a molecular weight of 170.21 g/mol. Its IUPAC name is (2Z,4E)-6-ethoxy-2-hydroxy-5-methylhexa-2,4-dienal.
| Compound Name | (2Z,4E)-6-ethoxy-2-hydroxy-5-methylhexa-2,4-dienal |
|---|---|
| PubChem CID | 90321322 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | (2Z,4E)-6-ethoxy-2-hydroxy-5-methylhexa-2,4-dienal |
| SMILES | CCOC/C(C)=C/C=C(\O)C=O |
| InChI | InChI=1S/C9H14O3/c1-3-12-7-8(2)4-5-9(11)6-10/h4-6,11H,3,7H2,1-2H3/b8-4+,9-5- |
| InChIKey | KYBJONIKYSBVDS-HXGSSHHBSA-N |
| XLogP | 1.61 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|