C10H10F3N5O6 — CID 90324308
1-[(2R,3R,5R)-5-azido-3,4-dihydroxy-5-(hydroxymethyl)-3-(trifluoromethyl)oxolan-2-yl]-5,6-dideuteriopyrimidine-2,4-dione (PubChem CID 90324308) has the molecular formula C10H10F3N5O6 and a molecular weight of 355.23 g/mol. Its IUPAC name is 1-[(2R,3R,5R)-5-azido-3,4-dihydroxy-5-(hydroxymethyl)-3-(trifluoromethyl)oxolan-2-yl]-5,6-dideuteriopyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,5R)-5-azido-3,4-dihydroxy-5-(hydroxymethyl)-3-(trifluoromethyl)oxolan-2-yl]-5,6-dideuteriopyrimidine-2,4-dione |
|---|---|
| PubChem CID | 90324308 |
| Molecular Formula | C10H10F3N5O6 |
| Molecular Weight | 355.23 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | 1-[(2R,3R,5R)-5-azido-3,4-dihydroxy-5-(hydroxymethyl)-3-(trifluoromethyl)oxolan-2-yl]-5,6-dideuteriopyrimidine-2,4-dione |
| SMILES | [2H]c1c([2H])n([C@@H]2O[C@@](CO)(N=[N+]=[N-])C(O)[C@]2(O)C(F)(F)F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H10F3N5O6/c11-10(12,13)9(23)5(21)8(3-19,16-17-14)24-6(9)18-2-1-4(20)15-7(18)22/h1-2,5-6,19,21,23H,3H2,(H,15,20,22)/t5?,6-,8-,9-/m1/s1/i1D,2D |
| InChIKey | CPULXIPOMKHZDP-RAXMKPQVSA-N |
| XLogP | -1.28 |
| TPSA | 173.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.23 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|