C9H9F2N5O5 — CID 90324318
1-[(2R,5R)-5-azido-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5,6-dideuteriopyrimidine-2,4-dione (PubChem CID 90324318) has the molecular formula C9H9F2N5O5 and a molecular weight of 307.21 g/mol. Its IUPAC name is 1-[(2R,5R)-5-azido-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5,6-dideuteriopyrimidine-2,4-dione.
| Compound Name | 1-[(2R,5R)-5-azido-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5,6-dideuteriopyrimidine-2,4-dione |
|---|---|
| PubChem CID | 90324318 |
| Molecular Formula | C9H9F2N5O5 |
| Molecular Weight | 307.21 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 1-[(2R,5R)-5-azido-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5,6-dideuteriopyrimidine-2,4-dione |
| SMILES | [2H]c1c([2H])n([C@@H]2O[C@@](CO)(N=[N+]=[N-])C(O)C2(F)F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C9H9F2N5O5/c10-9(11)5(19)8(3-17,14-15-12)21-6(9)16-2-1-4(18)13-7(16)20/h1-2,5-6,17,19H,3H2,(H,13,18,20)/t5?,6-,8-/m1/s1/i1D,2D |
| InChIKey | NRQCGDNIEPALAF-RDIKJWDQSA-N |
| XLogP | -0.94 |
| TPSA | 153.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.21 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|