C19H30NO5P — CID 90324894
1-butyl-4-(dimethoxyphosphorylmethyl)-7-hydroxy-2,2-dimethyl-3,4-dihydroquinoline-6-carbaldehyde (PubChem CID 90324894) has the molecular formula C19H30NO5P and a molecular weight of 383.43 g/mol. Its IUPAC name is 1-butyl-4-(dimethoxyphosphorylmethyl)-7-hydroxy-2,2-dimethyl-3,4-dihydroquinoline-6-carbaldehyde.
| Compound Name | 1-butyl-4-(dimethoxyphosphorylmethyl)-7-hydroxy-2,2-dimethyl-3,4-dihydroquinoline-6-carbaldehyde |
|---|---|
| PubChem CID | 90324894 |
| Molecular Formula | C19H30NO5P |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | 1-butyl-4-(dimethoxyphosphorylmethyl)-7-hydroxy-2,2-dimethyl-3,4-dihydroquinoline-6-carbaldehyde |
| SMILES | CCCCN1c2cc(O)c(C=O)cc2C(CP(=O)(OC)OC)CC1(C)C |
| InChI | InChI=1S/C19H30NO5P/c1-6-7-8-20-17-10-18(22)14(12-21)9-16(17)15(11-19(20,2)3)13-26(23,24-4)25-5/h9-10,12,15,22H,6-8,11,13H2,1-5H3 |
| InChIKey | QPYXJTMCXASBLP-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|