C18H13ClMg — CID 90343387
magnesium;1,3-diphenylbenzene-5-ide;chloride (PubChem CID 90343387) has the molecular formula C18H13ClMg and a molecular weight of 289.06 g/mol. Its IUPAC name is magnesium;1,3-diphenylbenzene-5-ide;chloride.
| Compound Name | magnesium;1,3-diphenylbenzene-5-ide;chloride |
|---|---|
| PubChem CID | 90343387 |
| Molecular Formula | C18H13ClMg |
| Molecular Weight | 289.06 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | magnesium;1,3-diphenylbenzene-5-ide;chloride |
| SMILES | [Cl-].[Mg+2].[c-]1cc(-c2ccccc2)cc(-c2ccccc2)c1 |
| InChI | InChI=1S/C18H13.ClH.Mg/c1-3-8-15(9-4-1)17-12-7-13-18(14-17)16-10-5-2-6-11-16;;/h1-6,8-14H;1H;/q-1;;+2/p-1 |
| InChIKey | OCBMOPFXAQESQY-UHFFFAOYSA-M |
| XLogP | 1.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.06 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|